C10H15N3O3S — CID 110467315
N-(1,1-dioxothiolan-3-yl)-N,1-dimethylimidazole-2-carboxamide (PubChem CID 110467315) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N,1-dimethylimidazole-2-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N,1-dimethylimidazole-2-carboxamide |
|---|---|
| PubChem CID | 110467315 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N,1-dimethylimidazole-2-carboxamide |
| SMILES | CN(C(=O)c1nccn1C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H15N3O3S/c1-12-5-4-11-9(12)10(14)13(2)8-3-6-17(15,16)7-8/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | DBGFNOQRPCGCLE-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |