C10H15N3O2 — CID 110467692
N-cyclohexyl-5-oxo-1,4-dihydropyrazole-3-carboxamide (PubChem CID 110467692) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is N-cyclohexyl-5-oxo-1,4-dihydropyrazole-3-carboxamide.
| Compound Name | N-cyclohexyl-5-oxo-1,4-dihydropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 110467692 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N-cyclohexyl-5-oxo-1,4-dihydropyrazole-3-carboxamide |
| SMILES | O=C1CC(C(=O)NC2CCCCC2)=NN1 |
| InChI | InChI=1S/C10H15N3O2/c14-9-6-8(12-13-9)10(15)11-7-4-2-1-3-5-7/h7H,1-6H2,(H,11,15)(H,13,14) |
| InChIKey | QZXJKGOHKGTEKU-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |