C9H15F3N2O2 — CID 110479366
N-[2-(dimethylamino)ethyl]-4,4,4-trifluoro-N-methyl-3-oxobutanamide (PubChem CID 110479366) has the molecular formula C9H15F3N2O2 and a molecular weight of 240.22 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4,4,4-trifluoro-N-methyl-3-oxobutanamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-4,4,4-trifluoro-N-methyl-3-oxobutanamide |
|---|---|
| PubChem CID | 110479366 |
| Molecular Formula | C9H15F3N2O2 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4,4,4-trifluoro-N-methyl-3-oxobutanamide |
| SMILES | CN(C)CCN(C)C(=O)CC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H15F3N2O2/c1-13(2)4-5-14(3)8(16)6-7(15)9(10,11)12/h4-6H2,1-3H3 |
| InChIKey | UAZSUDXFSQZPGD-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|