About (6-iodo-1-oxo-1-phenylhexan-3-yl) 2-iodoacetate
(6-iodo-1-oxo-1-phenylhexan-3-yl) 2-iodoacetate (PubChem CID 11049199) has the molecular formula C14H16I2O3
and a molecular weight of 486.09 g/mol. Its IUPAC name is (6-iodo-1-oxo-1-phenylhexan-3-yl) 2-iodoacetate.
Molecular Properties
| Compound Name | (6-iodo-1-oxo-1-phenylhexan-3-yl) 2-iodoacetate |
| PubChem CID | 11049199 |
| Molecular Formula | C14H16I2O3 |
| Molecular Weight | 486.09 g/mol |
| Exact Mass | 485.92 |
| IUPAC Name | (6-iodo-1-oxo-1-phenylhexan-3-yl) 2-iodoacetate |
| SMILES | O=C(CI)OC(CCCI)CC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H16I2O3/c15-8-4-7-12(19-14(18)10-16)9-13(17)11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2 |
| InChIKey | ZTYDJYFKPPHIKZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.09 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (6-iodo-1-oxo-1-phenylhexan-3-yl) 2-iodoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-iodo-1-oxo-1-phenylhexan-3-yl) 2-iodoacetate?
The IUPAC name of (6-iodo-1-oxo-1-phenylhexan-3-yl) 2-iodoacetate (CID 11049199) is (6-iodo-1-oxo-1-phenylhexan-3-yl) 2-iodoacetate.
What is the SMILES notation for (6-iodo-1-oxo-1-phenylhexan-3-yl) 2-iodoacetate?
The canonical SMILES for (6-iodo-1-oxo-1-phenylhexan-3-yl) 2-iodoacetate is O=C(CI)OC(CCCI)CC(=O)c1ccccc1.
What is the InChIKey of (6-iodo-1-oxo-1-phenylhexan-3-yl) 2-iodoacetate?
The InChIKey is ZTYDJYFKPPHIKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16I2O3/c15-8-4-7-12(19-14(18)10-16)9-13(17)11-5-2-1-3-6-11/h1-3,5-6,12H,4,7-10H2.
What are the key properties of (6-iodo-1-oxo-1-phenylhexan-3-yl) 2-iodoacetate?
(6-iodo-1-oxo-1-phenylhexan-3-yl) 2-iodoacetate has a molecular weight of 486.09 g/mol, XLogP of 3.82, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-iodo-1-oxo-1-phenylhexan-3-yl) 2-iodoacetate is sourced from PubChem (CID 11049199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).