C16H11Cl2NO4 — CID 110494316
1,3-benzoxazol-5-yl 2-(2,4-dichlorophenoxy)propanoate (PubChem CID 110494316) has the molecular formula C16H11Cl2NO4 and a molecular weight of 352.17 g/mol. Its IUPAC name is 1,3-benzoxazol-5-yl 2-(2,4-dichlorophenoxy)propanoate.
| Compound Name | 1,3-benzoxazol-5-yl 2-(2,4-dichlorophenoxy)propanoate |
|---|---|
| PubChem CID | 110494316 |
| Molecular Formula | C16H11Cl2NO4 |
| Molecular Weight | 352.17 g/mol |
| Exact Mass | 351.01 |
| IUPAC Name | 1,3-benzoxazol-5-yl 2-(2,4-dichlorophenoxy)propanoate |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)Oc1ccc2ocnc2c1 |
| InChI | InChI=1S/C16H11Cl2NO4/c1-9(22-14-4-2-10(17)6-12(14)18)16(20)23-11-3-5-15-13(7-11)19-8-21-15/h2-9H,1H3 |
| InChIKey | KSFPYFXVCCCSTA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.17 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|