C16H20I2O3 — CID 11049529
(3E)-7-iodo-3-(7-iodo-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-ylidene)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one (PubChem CID 11049529) has the molecular formula C16H20I2O3 and a molecular weight of 514.14 g/mol. Its IUPAC name is (3E)-7-iodo-3-(7-iodo-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-ylidene)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one.
| Compound Name | (3E)-7-iodo-3-(7-iodo-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-ylidene)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 11049529 |
| Molecular Formula | C16H20I2O3 |
| Molecular Weight | 514.14 g/mol |
| Exact Mass | 513.95 |
| IUPAC Name | (3E)-7-iodo-3-(7-iodo-3a,4,5,6,7,7a-hexahydro-3H-1-benzofuran-2-ylidene)-3a,4,5,6,7,7a-hexahydro-1-benzofuran-2-one |
| SMILES | O=C1OC2C(I)CCCC2/C1=C1/CC2CCCC(I)C2O1 |
| InChI | InChI=1S/C16H20I2O3/c17-10-5-1-3-8-7-12(20-14(8)10)13-9-4-2-6-11(18)15(9)21-16(13)19/h8-11,14-15H,1-7H2/b13-12+ |
| InChIKey | PSIQQNKLZIQGSC-OUKQBFOZSA-N |
| XLogP | 4.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.14 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|