C11H11FN2O4 — CID 110507159
2-[carboxymethyl-[(Z)-(4-fluorophenyl)methylideneamino]amino]acetic acid (PubChem CID 110507159) has the molecular formula C11H11FN2O4 and a molecular weight of 254.22 g/mol. Its IUPAC name is 2-[carboxymethyl-[(Z)-(4-fluorophenyl)methylideneamino]amino]acetic acid.
| Compound Name | 2-[carboxymethyl-[(Z)-(4-fluorophenyl)methylideneamino]amino]acetic acid |
|---|---|
| PubChem CID | 110507159 |
| Molecular Formula | C11H11FN2O4 |
| Molecular Weight | 254.22 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 2-[carboxymethyl-[(Z)-(4-fluorophenyl)methylideneamino]amino]acetic acid |
| SMILES | O=C(O)CN(CC(=O)O)/N=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C11H11FN2O4/c12-9-3-1-8(2-4-9)5-13-14(6-10(15)16)7-11(17)18/h1-5H,6-7H2,(H,15,16)(H,17,18)/b13-5- |
| InChIKey | ZERGNNNMYUFWPE-ACAGNQJTSA-N |
| XLogP | 0.63 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.22 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|