C26H34F2N6O4 — CID 177447304
1-[(E)-(4-fluorophenyl)methylideneamino]-3-[6-[[[(E)-(4-fluorophenyl)methylideneamino]-(2-hydroxyethyl)carbamoyl]amino]hexyl]-1-(2-hydroxyethyl)urea (PubChem CID 177447304) has the molecular formula C26H34F2N6O4 and a molecular weight of 532.59 g/mol. Its IUPAC name is 1-[(E)-(4-fluorophenyl)methylideneamino]-3-[6-[[[(E)-(4-fluorophenyl)methylideneamino]-(2-hydroxyethyl)carbamoyl]amino]hexyl]-1-(2-hydroxyethyl)urea.
| Compound Name | 1-[(E)-(4-fluorophenyl)methylideneamino]-3-[6-[[[(E)-(4-fluorophenyl)methylideneamino]-(2-hydroxyethyl)carbamoyl]amino]hexyl]-1-(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 177447304 |
| Molecular Formula | C26H34F2N6O4 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | 1-[(E)-(4-fluorophenyl)methylideneamino]-3-[6-[[[(E)-(4-fluorophenyl)methylideneamino]-(2-hydroxyethyl)carbamoyl]amino]hexyl]-1-(2-hydroxyethyl)urea |
| SMILES | O=C(NCCCCCCNC(=O)N(CCO)/N=C/c1ccc(F)cc1)N(CCO)/N=C/c1ccc(F)cc1 |
| InChI | InChI=1S/C26H34F2N6O4/c27-23-9-5-21(6-10-23)19-31-33(15-17-35)25(37)29-13-3-1-2-4-14-30-26(38)34(16-18-36)32-20-22-7-11-24(28)12-8-22/h5-12,19-20,35-36H,1-4,13-18H2,(H,29,37)(H,30,38)/b31-19+,32-20+ |
| InChIKey | AIVPIAZRHQEUKN-GKTLAHRSSA-N |
| XLogP | 2.90 |
| TPSA | 129.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|