C13H15FN2O — CID 176910870
N-but-3-enyl-N-[(4-fluorophenyl)methylideneamino]acetamide (PubChem CID 176910870) has the molecular formula C13H15FN2O and a molecular weight of 234.27 g/mol. Its IUPAC name is N-but-3-enyl-N-[(4-fluorophenyl)methylideneamino]acetamide.
| Compound Name | N-but-3-enyl-N-[(4-fluorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 176910870 |
| Molecular Formula | C13H15FN2O |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | N-but-3-enyl-N-[(4-fluorophenyl)methylideneamino]acetamide |
| SMILES | C=CCCN(N=Cc1ccc(F)cc1)C(C)=O |
| InChI | InChI=1S/C13H15FN2O/c1-3-4-9-16(11(2)17)15-10-12-5-7-13(14)8-6-12/h3,5-8,10H,1,4,9H2,2H3 |
| InChIKey | IMXVVFFBNDNRGZ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|