C40H58O2S2Si2 — CID 11050741
tert-butyl-[(4S,5S,6R,7R)-8-(1,3-dithian-2-yl)-4,6,8-trimethyl-7-triphenylsilyloxynon-1-en-5-yl]oxy-dimethylsilane (PubChem CID 11050741) has the molecular formula C40H58O2S2Si2 and a molecular weight of 691.21 g/mol. Its IUPAC name is tert-butyl-[(4S,5S,6R,7R)-8-(1,3-dithian-2-yl)-4,6,8-trimethyl-7-triphenylsilyloxynon-1-en-5-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(4S,5S,6R,7R)-8-(1,3-dithian-2-yl)-4,6,8-trimethyl-7-triphenylsilyloxynon-1-en-5-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 11050741 |
| Molecular Formula | C40H58O2S2Si2 |
| Molecular Weight | 691.21 g/mol |
| Exact Mass | 690.34 |
| IUPAC Name | tert-butyl-[(4S,5S,6R,7R)-8-(1,3-dithian-2-yl)-4,6,8-trimethyl-7-triphenylsilyloxynon-1-en-5-yl]oxy-dimethylsilane |
| SMILES | C=CC[C@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)[C@@H](O[Si](c1ccccc1)(c1ccccc1)c1ccccc1)C(C)(C)C1SCCCS1 |
| InChI | InChI=1S/C40H58O2S2Si2/c1-11-22-31(2)36(41-45(9,10)39(4,5)6)32(3)37(40(7,8)38-43-29-21-30-44-38)42-46(33-23-15-12-16-24-33,34-25-17-13-18-26-34)35-27-19-14-20-28-35/h11-20,23-28,31-32,36-38H,1,21-22,29-30H2,2-10H3/t31-,32+,36-,37+/m0/s1 |
| InChIKey | CSWSLXSAHXATKW-HDQBFFLKSA-N |
| XLogP | 9.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.21 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|