C12H16N2O6S2 — CID 11057175
3-ethyl-2-methyl-5-nitro-1,3-benzothiazol-3-ium;ethyl sulfate (PubChem CID 11057175) has the molecular formula C12H16N2O6S2 and a molecular weight of 348.40 g/mol. Its IUPAC name is 3-ethyl-2-methyl-5-nitro-1,3-benzothiazol-3-ium;ethyl sulfate.
| Compound Name | 3-ethyl-2-methyl-5-nitro-1,3-benzothiazol-3-ium;ethyl sulfate |
|---|---|
| PubChem CID | 11057175 |
| Molecular Formula | C12H16N2O6S2 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | 3-ethyl-2-methyl-5-nitro-1,3-benzothiazol-3-ium;ethyl sulfate |
| SMILES | CCOS(=O)(=O)[O-].CC[n+]1c(C)sc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C10H11N2O2S.C2H6O4S/c1-3-11-7(2)15-10-5-4-8(12(13)14)6-9(10)11;1-2-6-7(3,4)5/h4-6H,3H2,1-2H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | LWGCRTAGOSALCZ-UHFFFAOYSA-M |
| XLogP | 1.91 |
| TPSA | 113.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|