C18H16IN3O5 — CID 139255773
6-(2,4-dinitrophenoxy)-1-ethyl-2-methylquinolin-1-ium iodide (PubChem CID 139255773) has the molecular formula C18H16IN3O5 and a molecular weight of 481.25 g/mol. Its IUPAC name is 6-(2,4-dinitrophenoxy)-1-ethyl-2-methylquinolin-1-ium iodide.
| Compound Name | 6-(2,4-dinitrophenoxy)-1-ethyl-2-methylquinolin-1-ium iodide |
|---|---|
| PubChem CID | 139255773 |
| Molecular Formula | C18H16IN3O5 |
| Molecular Weight | 481.25 g/mol |
| Exact Mass | 481.01 |
| IUPAC Name | 6-(2,4-dinitrophenoxy)-1-ethyl-2-methylquinolin-1-ium iodide |
| SMILES | CC[n+]1c(C)ccc2cc(Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])ccc21.[I-] |
| InChI | InChI=1S/C18H16N3O5.HI/c1-3-19-12(2)4-5-13-10-15(7-8-16(13)19)26-18-9-6-14(20(22)23)11-17(18)21(24)25;/h4-11H,3H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | KWNHSJFYKCTWHD-UHFFFAOYSA-M |
| XLogP | 1.07 |
| TPSA | 99.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|