About tert-butyl-[ethoxy-(4-nitrophenyl)-oxo-λ6-sulfanylidene]azanium
tert-butyl-[ethoxy-(4-nitrophenyl)-oxo-λ6-sulfanylidene]azanium (PubChem CID 134839720) has the molecular formula C12H19N2O4S+
and a molecular weight of 287.36 g/mol. Its IUPAC name is tert-butyl-[ethoxy-(4-nitrophenyl)-oxo-λ6-sulfanylidene]azanium.
Molecular Properties
| Compound Name | tert-butyl-[ethoxy-(4-nitrophenyl)-oxo-λ6-sulfanylidene]azanium |
| PubChem CID | 134839720 |
| Molecular Formula | C12H19N2O4S+ |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | tert-butyl-[ethoxy-(4-nitrophenyl)-oxo-λ6-sulfanylidene]azanium |
| SMILES | CCOS(=O)(=[NH+]C(C)(C)C)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H18N2O4S/c1-5-18-19(17,13-12(2,3)4)11-8-6-10(7-9-11)14(15)16/h6-9H,5H2,1-4H3/p+1 |
| InChIKey | MUWRMYYTSYLBDP-UHFFFAOYSA-O |
| XLogP | 1.25 |
| TPSA | 83.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-[ethoxy-(4-nitrophenyl)-oxo-λ6-sulfanylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-[ethoxy-(4-nitrophenyl)-oxo-λ6-sulfanylidene]azanium?
The IUPAC name of tert-butyl-[ethoxy-(4-nitrophenyl)-oxo-λ6-sulfanylidene]azanium (CID 134839720) is tert-butyl-[ethoxy-(4-nitrophenyl)-oxo-λ6-sulfanylidene]azanium.
What is the SMILES notation for tert-butyl-[ethoxy-(4-nitrophenyl)-oxo-λ6-sulfanylidene]azanium?
The canonical SMILES for tert-butyl-[ethoxy-(4-nitrophenyl)-oxo-λ6-sulfanylidene]azanium is CCOS(=O)(=[NH+]C(C)(C)C)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of tert-butyl-[ethoxy-(4-nitrophenyl)-oxo-λ6-sulfanylidene]azanium?
The InChIKey is MUWRMYYTSYLBDP-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H18N2O4S/c1-5-18-19(17,13-12(2,3)4)11-8-6-10(7-9-11)14(15)16/h6-9H,5H2,1-4H3/p+1.
What are the key properties of tert-butyl-[ethoxy-(4-nitrophenyl)-oxo-λ6-sulfanylidene]azanium?
tert-butyl-[ethoxy-(4-nitrophenyl)-oxo-λ6-sulfanylidene]azanium has a molecular weight of 287.36 g/mol, XLogP of 1.25, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-[ethoxy-(4-nitrophenyl)-oxo-λ6-sulfanylidene]azanium is sourced from PubChem (CID 134839720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).