C26H42N2O12P2S2 — CID 161105439
4-(2-diethoxyphosphorylpropan-2-ylsulfonyl)aniline;1-(2-diethoxyphosphorylpropan-2-ylsulfonyl)-4-nitrobenzene (PubChem CID 161105439) has the molecular formula C26H42N2O12P2S2 and a molecular weight of 700.71 g/mol. Its IUPAC name is 4-(2-diethoxyphosphorylpropan-2-ylsulfonyl)aniline;1-(2-diethoxyphosphorylpropan-2-ylsulfonyl)-4-nitrobenzene.
| Compound Name | 4-(2-diethoxyphosphorylpropan-2-ylsulfonyl)aniline;1-(2-diethoxyphosphorylpropan-2-ylsulfonyl)-4-nitrobenzene |
|---|---|
| PubChem CID | 161105439 |
| Molecular Formula | C26H42N2O12P2S2 |
| Molecular Weight | 700.71 g/mol |
| Exact Mass | 700.17 |
| IUPAC Name | 4-(2-diethoxyphosphorylpropan-2-ylsulfonyl)aniline;1-(2-diethoxyphosphorylpropan-2-ylsulfonyl)-4-nitrobenzene |
| SMILES | CCOP(=O)(OCC)C(C)(C)S(=O)(=O)c1ccc(N)cc1.CCOP(=O)(OCC)C(C)(C)S(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H20NO7PS.C13H22NO5PS/c1-5-20-22(17,21-6-2)13(3,4)23(18,19)12-9-7-11(8-10-12)14(15)16;1-5-18-20(15,19-6-2)13(3,4)21(16,17)12-9-7-11(14)8-10-12/h7-10H,5-6H2,1-4H3;7-10H,5-6,14H2,1-4H3 |
| InChIKey | UIZHUIBIFPOTLJ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 208.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.71 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|