C22H34N2O8P2S2 — CID 160819526
4-(diethylphosphorylmethylsulfonyl)aniline;1-(diethylphosphorylmethylsulfonyl)-4-nitrobenzene (PubChem CID 160819526) has the molecular formula C22H34N2O8P2S2 and a molecular weight of 580.60 g/mol. Its IUPAC name is 4-(diethylphosphorylmethylsulfonyl)aniline;1-(diethylphosphorylmethylsulfonyl)-4-nitrobenzene.
| Compound Name | 4-(diethylphosphorylmethylsulfonyl)aniline;1-(diethylphosphorylmethylsulfonyl)-4-nitrobenzene |
|---|---|
| PubChem CID | 160819526 |
| Molecular Formula | C22H34N2O8P2S2 |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.12 |
| IUPAC Name | 4-(diethylphosphorylmethylsulfonyl)aniline;1-(diethylphosphorylmethylsulfonyl)-4-nitrobenzene |
| SMILES | CCP(=O)(CC)CS(=O)(=O)c1ccc(N)cc1.CCP(=O)(CC)CS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H16NO5PS.C11H18NO3PS/c1-3-18(15,4-2)9-19(16,17)11-7-5-10(6-8-11)12(13)14;1-3-16(13,4-2)9-17(14,15)11-7-5-10(12)6-8-11/h5-8H,3-4,9H2,1-2H3;5-8H,3-4,9,12H2,1-2H3 |
| InChIKey | SFIUANMOYLDEJS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 171.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|