C20H34O3Si — CID 11057242
(Z)-3-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-4-phenylmethoxybut-2-en-1-ol (PubChem CID 11057242) has the molecular formula C20H34O3Si and a molecular weight of 350.58 g/mol. Its IUPAC name is (Z)-3-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-4-phenylmethoxybut-2-en-1-ol.
| Compound Name | (Z)-3-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-4-phenylmethoxybut-2-en-1-ol |
|---|---|
| PubChem CID | 11057242 |
| Molecular Formula | C20H34O3Si |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | (Z)-3-[[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxymethyl]-4-phenylmethoxybut-2-en-1-ol |
| SMILES | CC(C)C(C)(C)[Si](C)(C)OC/C(=C\CO)COCc1ccccc1 |
| InChI | InChI=1S/C20H34O3Si/c1-17(2)20(3,4)24(5,6)23-16-19(12-13-21)15-22-14-18-10-8-7-9-11-18/h7-12,17,21H,13-16H2,1-6H3/b19-12- |
| InChIKey | JFXCUSCXOWTQET-UNOMPAQXSA-N |
| XLogP | 4.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|