C34H28O4 — CID 11060168
(4Z)-4-[1,3,3-tris(4-methoxyphenyl)prop-2-enylidene]naphthalen-1-one (PubChem CID 11060168) has the molecular formula C34H28O4 and a molecular weight of 500.59 g/mol. Its IUPAC name is (4Z)-4-[1,3,3-tris(4-methoxyphenyl)prop-2-enylidene]naphthalen-1-one.
| Compound Name | (4Z)-4-[1,3,3-tris(4-methoxyphenyl)prop-2-enylidene]naphthalen-1-one |
|---|---|
| PubChem CID | 11060168 |
| Molecular Formula | C34H28O4 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.20 |
| IUPAC Name | (4Z)-4-[1,3,3-tris(4-methoxyphenyl)prop-2-enylidene]naphthalen-1-one |
| SMILES | COc1ccc(C(=C/C(=C2\C=CC(=O)c3ccccc32)c2ccc(OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H28O4/c1-36-26-14-8-23(9-15-26)32(24-10-16-27(37-2)17-11-24)22-33(25-12-18-28(38-3)19-13-25)30-20-21-34(35)31-7-5-4-6-29(30)31/h4-22H,1-3H3/b33-30- |
| InChIKey | FVSPQBBFBWXETJ-MEIHLTSWSA-N |
| XLogP | 7.51 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|