C28H52O8Si — CID 11060635
[(2R,4R,6R,8S,10S)-8-(2-acetyloxybutyl)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-1,7-dioxaspiro[5.5]undecan-2-yl]methyl 2,2-dimethylpropanoate (PubChem CID 11060635) has the molecular formula C28H52O8Si and a molecular weight of 544.80 g/mol. Its IUPAC name is [(2R,4R,6R,8S,10S)-8-(2-acetyloxybutyl)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-1,7-dioxaspiro[5.5]undecan-2-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(2R,4R,6R,8S,10S)-8-(2-acetyloxybutyl)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-1,7-dioxaspiro[5.5]undecan-2-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11060635 |
| Molecular Formula | C28H52O8Si |
| Molecular Weight | 544.80 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | [(2R,4R,6R,8S,10S)-8-(2-acetyloxybutyl)-4-[tert-butyl(dimethyl)silyl]oxy-10-methoxy-1,7-dioxaspiro[5.5]undecan-2-yl]methyl 2,2-dimethylpropanoate |
| SMILES | CCC(C[C@@H]1C[C@H](OC)C[C@@]2(C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H](COC(=O)C(C)(C)C)O2)O1)OC(C)=O |
| InChI | InChI=1S/C28H52O8Si/c1-12-20(33-19(2)29)13-21-14-22(31-9)16-28(34-21)17-23(36-37(10,11)27(6,7)8)15-24(35-28)18-32-25(30)26(3,4)5/h20-24H,12-18H2,1-11H3/t20?,21-,22+,23-,24-,28-/m1/s1 |
| InChIKey | YBWQZEJMROEZKJ-DYWGMJTJSA-N |
| XLogP | 5.77 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.80 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|