C31H50O6Si — CID 54190716
(2,6-dimethylphenyl) 6-[4-[tert-butyl(dimethyl)silyl]oxy-1,7-dioxaspiro[5.5]undecan-2-yl]-2,4-dimethyl-3-oxohexanoate (PubChem CID 54190716) has the molecular formula C31H50O6Si and a molecular weight of 546.82 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 6-[4-[tert-butyl(dimethyl)silyl]oxy-1,7-dioxaspiro[5.5]undecan-2-yl]-2,4-dimethyl-3-oxohexanoate.
| Compound Name | (2,6-dimethylphenyl) 6-[4-[tert-butyl(dimethyl)silyl]oxy-1,7-dioxaspiro[5.5]undecan-2-yl]-2,4-dimethyl-3-oxohexanoate |
|---|---|
| PubChem CID | 54190716 |
| Molecular Formula | C31H50O6Si |
| Molecular Weight | 546.82 g/mol |
| Exact Mass | 546.34 |
| IUPAC Name | (2,6-dimethylphenyl) 6-[4-[tert-butyl(dimethyl)silyl]oxy-1,7-dioxaspiro[5.5]undecan-2-yl]-2,4-dimethyl-3-oxohexanoate |
| SMILES | Cc1cccc(C)c1OC(=O)C(C)C(=O)C(C)CCC1CC(O[Si](C)(C)C(C)(C)C)CC2(CCCCO2)O1 |
| InChI | InChI=1S/C31H50O6Si/c1-21(27(32)24(4)29(33)35-28-22(2)13-12-14-23(28)3)15-16-25-19-26(37-38(8,9)30(5,6)7)20-31(36-25)17-10-11-18-34-31/h12-14,21,24-26H,10-11,15-20H2,1-9H3 |
| InChIKey | PIHRXJUSXROKFV-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.82 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|