C11H13N3S2 — CID 11064883
2-(3-azidothiophen-2-yl)-4,5-dimethyl-3,6-dihydro-2H-thiopyran (PubChem CID 11064883) has the molecular formula C11H13N3S2 and a molecular weight of 251.38 g/mol. Its IUPAC name is 2-(3-azidothiophen-2-yl)-4,5-dimethyl-3,6-dihydro-2H-thiopyran.
| Compound Name | 2-(3-azidothiophen-2-yl)-4,5-dimethyl-3,6-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 11064883 |
| Molecular Formula | C11H13N3S2 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-(3-azidothiophen-2-yl)-4,5-dimethyl-3,6-dihydro-2H-thiopyran |
| SMILES | CC1=C(C)CC(c2sccc2N=[N+]=[N-])SC1 |
| InChI | InChI=1S/C11H13N3S2/c1-7-5-10(16-6-8(7)2)11-9(13-14-12)3-4-15-11/h3-4,10H,5-6H2,1-2H3 |
| InChIKey | QRNWCPGDHXWHFS-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|