C11H14S2 — CID 14249568
4,5-dimethyl-2-thiophen-2-yl-3,6-dihydro-2H-thiopyran (PubChem CID 14249568) has the molecular formula C11H14S2 and a molecular weight of 210.37 g/mol. Its IUPAC name is 4,5-dimethyl-2-thiophen-2-yl-3,6-dihydro-2H-thiopyran.
| Compound Name | 4,5-dimethyl-2-thiophen-2-yl-3,6-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 14249568 |
| Molecular Formula | C11H14S2 |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | 4,5-dimethyl-2-thiophen-2-yl-3,6-dihydro-2H-thiopyran |
| SMILES | CC1=C(C)CC(c2cccs2)SC1 |
| InChI | InChI=1S/C11H14S2/c1-8-6-11(13-7-9(8)2)10-4-3-5-12-10/h3-5,11H,6-7H2,1-2H3 |
| InChIKey | QQUAHTHZRBKLAK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|