C9H10S2 — CID 148641519
2-(5-methyl-2,3-dihydrothiophen-2-yl)thiophene (PubChem CID 148641519) has the molecular formula C9H10S2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-(5-methyl-2,3-dihydrothiophen-2-yl)thiophene.
| Compound Name | 2-(5-methyl-2,3-dihydrothiophen-2-yl)thiophene |
|---|---|
| PubChem CID | 148641519 |
| Molecular Formula | C9H10S2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.02 |
| IUPAC Name | 2-(5-methyl-2,3-dihydrothiophen-2-yl)thiophene |
| SMILES | CC1=CCC(c2cccs2)S1 |
| InChI | InChI=1S/C9H10S2/c1-7-4-5-9(11-7)8-3-2-6-10-8/h2-4,6,9H,5H2,1H3 |
| InChIKey | NKCRALXICRYZCJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |