C7H7NS2 — CID 140995680
5-thiophen-2-yl-4,5-dihydro-1,2-thiazole (PubChem CID 140995680) has the molecular formula C7H7NS2 and a molecular weight of 169.27 g/mol. Its IUPAC name is 5-thiophen-2-yl-4,5-dihydro-1,2-thiazole.
| Compound Name | 5-thiophen-2-yl-4,5-dihydro-1,2-thiazole |
|---|---|
| PubChem CID | 140995680 |
| Molecular Formula | C7H7NS2 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.00 |
| IUPAC Name | 5-thiophen-2-yl-4,5-dihydro-1,2-thiazole |
| SMILES | C1=NSC(c2cccs2)C1 |
| InChI | InChI=1S/C7H7NS2/c1-2-6(9-5-1)7-3-4-8-10-7/h1-2,4-5,7H,3H2 |
| InChIKey | CNMHZEVGZKKELQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|