C21H27N3O — CID 110654033
1-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-[2-(1H-indol-3-yl)ethylamino]ethanone (PubChem CID 110654033) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is 1-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-[2-(1H-indol-3-yl)ethylamino]ethanone.
| Compound Name | 1-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-[2-(1H-indol-3-yl)ethylamino]ethanone |
|---|---|
| PubChem CID | 110654033 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | 1-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-2-[2-(1H-indol-3-yl)ethylamino]ethanone |
| SMILES | Cc1cc(C(=O)CNCCc2c[nH]c3ccccc23)c(C)n1C(C)C |
| InChI | InChI=1S/C21H27N3O/c1-14(2)24-15(3)11-19(16(24)4)21(25)13-22-10-9-17-12-23-20-8-6-5-7-18(17)20/h5-8,11-12,14,22-23H,9-10,13H2,1-4H3 |
| InChIKey | XXQBKSRIYZWQHJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 49.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|