About spiro[1,3-dithiolane-2,9'-thioxanthene]
spiro[1,3-dithiolane-2,9'-thioxanthene] (PubChem CID 11066133) has the molecular formula C15H12S3
and a molecular weight of 288.46 g/mol. Its IUPAC name is spiro[1,3-dithiolane-2,9'-thioxanthene].
Molecular Properties
| Compound Name | spiro[1,3-dithiolane-2,9'-thioxanthene] |
| PubChem CID | 11066133 |
| Molecular Formula | C15H12S3 |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | spiro[1,3-dithiolane-2,9'-thioxanthene] |
| SMILES | c1ccc2c(c1)Sc1ccccc1C21SCCS1 |
| InChI | InChI=1S/C15H12S3/c1-3-7-13-11(5-1)15(16-9-10-17-15)12-6-2-4-8-14(12)18-13/h1-8H,9-10H2 |
| InChIKey | QXXZGLPLNBQOII-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze spiro[1,3-dithiolane-2,9'-thioxanthene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dithiolane-2,9'-thioxanthene]?
The IUPAC name of spiro[1,3-dithiolane-2,9'-thioxanthene] (CID 11066133) is spiro[1,3-dithiolane-2,9'-thioxanthene].
What is the SMILES notation for spiro[1,3-dithiolane-2,9'-thioxanthene]?
The canonical SMILES for spiro[1,3-dithiolane-2,9'-thioxanthene] is c1ccc2c(c1)Sc1ccccc1C21SCCS1.
What is the InChIKey of spiro[1,3-dithiolane-2,9'-thioxanthene]?
The InChIKey is QXXZGLPLNBQOII-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12S3/c1-3-7-13-11(5-1)15(16-9-10-17-15)12-6-2-4-8-14(12)18-13/h1-8H,9-10H2.
What are the key properties of spiro[1,3-dithiolane-2,9'-thioxanthene]?
spiro[1,3-dithiolane-2,9'-thioxanthene] has a molecular weight of 288.46 g/mol, XLogP of 4.83, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dithiolane-2,9'-thioxanthene] is sourced from PubChem (CID 11066133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).