C14H11N3O5S — CID 110677053
1-methyl-2,4-dioxo-N-pyridin-2-yl-3,1-benzoxazine-6-sulfonamide (PubChem CID 110677053) has the molecular formula C14H11N3O5S and a molecular weight of 333.33 g/mol. Its IUPAC name is 1-methyl-2,4-dioxo-N-pyridin-2-yl-3,1-benzoxazine-6-sulfonamide.
| Compound Name | 1-methyl-2,4-dioxo-N-pyridin-2-yl-3,1-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 110677053 |
| Molecular Formula | C14H11N3O5S |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 1-methyl-2,4-dioxo-N-pyridin-2-yl-3,1-benzoxazine-6-sulfonamide |
| SMILES | Cn1c(=O)oc(=O)c2cc(S(=O)(=O)Nc3ccccn3)ccc21 |
| InChI | InChI=1S/C14H11N3O5S/c1-17-11-6-5-9(8-10(11)13(18)22-14(17)19)23(20,21)16-12-4-2-3-7-15-12/h2-8H,1H3,(H,15,16) |
| InChIKey | HFLBBTALGLTVGF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 111.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |