C13H20N2O3S2 — CID 110687853
3-(1,1-dioxothiazinan-2-yl)-N-(2-thiophen-2-ylethyl)propanamide (PubChem CID 110687853) has the molecular formula C13H20N2O3S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 3-(1,1-dioxothiazinan-2-yl)-N-(2-thiophen-2-ylethyl)propanamide.
| Compound Name | 3-(1,1-dioxothiazinan-2-yl)-N-(2-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 110687853 |
| Molecular Formula | C13H20N2O3S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 3-(1,1-dioxothiazinan-2-yl)-N-(2-thiophen-2-ylethyl)propanamide |
| SMILES | O=C(CCN1CCCCS1(=O)=O)NCCc1cccs1 |
| InChI | InChI=1S/C13H20N2O3S2/c16-13(14-7-5-12-4-3-10-19-12)6-9-15-8-1-2-11-20(15,17)18/h3-4,10H,1-2,5-9,11H2,(H,14,16) |
| InChIKey | IAZAQRQXZYNCPA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |