C8H11NO2S2 — CID 82127178
2-(thiophen-2-ylmethyl)-1,2-thiazolidine 1,1-dioxide (PubChem CID 82127178) has the molecular formula C8H11NO2S2 and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-(thiophen-2-ylmethyl)-1,2-thiazolidine 1,1-dioxide.
| Compound Name | 2-(thiophen-2-ylmethyl)-1,2-thiazolidine 1,1-dioxide |
|---|---|
| PubChem CID | 82127178 |
| Molecular Formula | C8H11NO2S2 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.02 |
| IUPAC Name | 2-(thiophen-2-ylmethyl)-1,2-thiazolidine 1,1-dioxide |
| SMILES | O=S1(=O)CCCN1Cc1cccs1 |
| InChI | InChI=1S/C8H11NO2S2/c10-13(11)6-2-4-9(13)7-8-3-1-5-12-8/h1,3,5H,2,4,6-7H2 |
| InChIKey | QCQXFTCJFZTZDX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |