C23H42O2Si — CID 11068900
tert-butyl-[[(1R,3S,5S,6S,9S,10R)-3,6-dimethyl-10-[(2-methylpropan-2-yl)oxy]-5-tricyclo[6.2.1.03,9]undec-8(11)-enyl]oxy]-dimethylsilane (PubChem CID 11068900) has the molecular formula C23H42O2Si and a molecular weight of 378.67 g/mol. Its IUPAC name is tert-butyl-[[(1R,3S,5S,6S,9S,10R)-3,6-dimethyl-10-[(2-methylpropan-2-yl)oxy]-5-tricyclo[6.2.1.03,9]undec-8(11)-enyl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1R,3S,5S,6S,9S,10R)-3,6-dimethyl-10-[(2-methylpropan-2-yl)oxy]-5-tricyclo[6.2.1.03,9]undec-8(11)-enyl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 11068900 |
| Molecular Formula | C23H42O2Si |
| Molecular Weight | 378.67 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | tert-butyl-[[(1R,3S,5S,6S,9S,10R)-3,6-dimethyl-10-[(2-methylpropan-2-yl)oxy]-5-tricyclo[6.2.1.03,9]undec-8(11)-enyl]oxy]-dimethylsilane |
| SMILES | C[C@H]1CC2=C[C@H]3C[C@@](C)(C[C@@H]1O[Si](C)(C)C(C)(C)C)[C@@H]2[C@@H]3OC(C)(C)C |
| InChI | InChI=1S/C23H42O2Si/c1-15-11-16-12-17-13-23(8,19(16)20(17)24-21(2,3)4)14-18(15)25-26(9,10)22(5,6)7/h12,15,17-20H,11,13-14H2,1-10H3/t15-,17-,18-,19-,20+,23-/m0/s1 |
| InChIKey | AXNWTBUDQBIJPA-QVPMCVFBSA-N |
| XLogP | 6.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.67 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|