C17H32O2Si — CID 10085953
[(1S,3aR,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,3a,6,7-hexahydroinden-5-yl]oxy-trimethylsilane (PubChem CID 10085953) has the molecular formula C17H32O2Si and a molecular weight of 296.53 g/mol. Its IUPAC name is [(1S,3aR,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,3a,6,7-hexahydroinden-5-yl]oxy-trimethylsilane.
| Compound Name | [(1S,3aR,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,3a,6,7-hexahydroinden-5-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10085953 |
| Molecular Formula | C17H32O2Si |
| Molecular Weight | 296.53 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | [(1S,3aR,7aS)-7a-methyl-1-[(2-methylpropan-2-yl)oxy]-1,2,3,3a,6,7-hexahydroinden-5-yl]oxy-trimethylsilane |
| SMILES | CC(C)(C)O[C@H]1CC[C@@H]2C=C(O[Si](C)(C)C)CC[C@]12C |
| InChI | InChI=1S/C17H32O2Si/c1-16(2,3)18-15-9-8-13-12-14(19-20(5,6)7)10-11-17(13,15)4/h12-13,15H,8-11H2,1-7H3/t13-,15+,17+/m1/s1 |
| InChIKey | UQBJZAFRLCWNIV-KMFMINBZSA-N |
| XLogP | 5.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|