C28H52O3Si2 — CID 102028916
[(3S,3aS,9aS,9bS)-9a-(2-methoxyethoxymethyl)-3a-methyl-7-(trimethylsilylmethyl)-2,3,4,8,9,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 102028916) has the molecular formula C28H52O3Si2 and a molecular weight of 492.89 g/mol. Its IUPAC name is [(3S,3aS,9aS,9bS)-9a-(2-methoxyethoxymethyl)-3a-methyl-7-(trimethylsilylmethyl)-2,3,4,8,9,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3S,3aS,9aS,9bS)-9a-(2-methoxyethoxymethyl)-3a-methyl-7-(trimethylsilylmethyl)-2,3,4,8,9,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 102028916 |
| Molecular Formula | C28H52O3Si2 |
| Molecular Weight | 492.89 g/mol |
| Exact Mass | 492.35 |
| IUPAC Name | [(3S,3aS,9aS,9bS)-9a-(2-methoxyethoxymethyl)-3a-methyl-7-(trimethylsilylmethyl)-2,3,4,8,9,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | COCCOC[C@]12CCC(C[Si](C)(C)C)=CC1=CC[C@]1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]21 |
| InChI | InChI=1S/C28H52O3Si2/c1-26(2,3)33(9,10)31-25-12-11-24-27(25,4)15-14-23-19-22(20-32(6,7)8)13-16-28(23,24)21-30-18-17-29-5/h14,19,24-25H,11-13,15-18,20-21H2,1-10H3/t24-,25+,27+,28-/m1/s1 |
| InChIKey | RCXFZCOVBPLLHP-JWNHKAHSSA-N |
| XLogP | 7.83 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.89 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|