C8H8ClF4IO3 — CID 11069190
ethyl 6-chloro-4,4,6,6-tetrafluoro-2-iodo-5-oxohexanoate (PubChem CID 11069190) has the molecular formula C8H8ClF4IO3 and a molecular weight of 390.50 g/mol. Its IUPAC name is ethyl 6-chloro-4,4,6,6-tetrafluoro-2-iodo-5-oxohexanoate.
| Compound Name | ethyl 6-chloro-4,4,6,6-tetrafluoro-2-iodo-5-oxohexanoate |
|---|---|
| PubChem CID | 11069190 |
| Molecular Formula | C8H8ClF4IO3 |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 389.91 |
| IUPAC Name | ethyl 6-chloro-4,4,6,6-tetrafluoro-2-iodo-5-oxohexanoate |
| SMILES | CCOC(=O)C(I)CC(F)(F)C(=O)C(F)(F)Cl |
| InChI | InChI=1S/C8H8ClF4IO3/c1-2-17-5(15)4(14)3-7(10,11)6(16)8(9,12)13/h4H,2-3H2,1H3 |
| InChIKey | GRLWNKMXLWUMNB-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|