C17H20ClNO3Se — CID 11069426
ethyl (6S,7S,8R,8aS)-6-chloro-5-oxo-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizine-7-carboxylate (PubChem CID 11069426) has the molecular formula C17H20ClNO3Se and a molecular weight of 400.76 g/mol. Its IUPAC name is ethyl (6S,7S,8R,8aS)-6-chloro-5-oxo-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizine-7-carboxylate.
| Compound Name | ethyl (6S,7S,8R,8aS)-6-chloro-5-oxo-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizine-7-carboxylate |
|---|---|
| PubChem CID | 11069426 |
| Molecular Formula | C17H20ClNO3Se |
| Molecular Weight | 400.76 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | ethyl (6S,7S,8R,8aS)-6-chloro-5-oxo-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizine-7-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]([Se]c2ccccc2)[C@@H]2CCCN2C(=O)[C@H]1Cl |
| InChI | InChI=1S/C17H20ClNO3Se/c1-2-22-17(21)13-14(18)16(20)19-10-6-9-12(19)15(13)23-11-7-4-3-5-8-11/h3-5,7-8,12-15H,2,6,9-10H2,1H3/t12-,13-,14-,15-/m0/s1 |
| InChIKey | DALFVAUKQYRFNP-AJNGGQMLSA-N |
| XLogP | 1.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.76 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|