C18H24ClNO3Se — CID 11048001
ethyl (7R,8R,8aS)-4-methyl-5-oxo-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-4-ium-7-carboxylate chloride (PubChem CID 11048001) has the molecular formula C18H24ClNO3Se and a molecular weight of 416.81 g/mol. Its IUPAC name is ethyl (7R,8R,8aS)-4-methyl-5-oxo-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-4-ium-7-carboxylate chloride.
| Compound Name | ethyl (7R,8R,8aS)-4-methyl-5-oxo-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-4-ium-7-carboxylate chloride |
|---|---|
| PubChem CID | 11048001 |
| Molecular Formula | C18H24ClNO3Se |
| Molecular Weight | 416.81 g/mol |
| Exact Mass | 417.06 |
| IUPAC Name | ethyl (7R,8R,8aS)-4-methyl-5-oxo-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-4-ium-7-carboxylate chloride |
| SMILES | CCOC(=O)[C@H]1CC(=O)[N+]2(C)CCC[C@H]2[C@@H]1[Se]c1ccccc1.[Cl-] |
| InChI | InChI=1S/C18H24NO3Se.ClH/c1-3-22-18(21)14-12-16(20)19(2)11-7-10-15(19)17(14)23-13-8-5-4-6-9-13;/h4-6,8-9,14-15,17H,3,7,10-12H2,1-2H3;1H/q+1;/p-1/t14-,15-,17+,19?;/m0./s1 |
| InChIKey | FRMRVILPLSOHEH-IJLIDTMHSA-M |
| XLogP | -1.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.81 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|