C17H21NO3Se — CID 11810667
ethyl (7R,8R,8aS)-5-oxo-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizine-7-carboxylate (PubChem CID 11810667) has the molecular formula C17H21NO3Se and a molecular weight of 366.32 g/mol. Its IUPAC name is ethyl (7R,8R,8aS)-5-oxo-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizine-7-carboxylate.
| Compound Name | ethyl (7R,8R,8aS)-5-oxo-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizine-7-carboxylate |
|---|---|
| PubChem CID | 11810667 |
| Molecular Formula | C17H21NO3Se |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | ethyl (7R,8R,8aS)-5-oxo-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizine-7-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC(=O)N2CCC[C@H]2[C@@H]1[Se]c1ccccc1 |
| InChI | InChI=1S/C17H21NO3Se/c1-2-21-17(20)13-11-15(19)18-10-6-9-14(18)16(13)22-12-7-4-3-5-8-12/h3-5,7-8,13-14,16H,2,6,9-11H2,1H3/t13-,14-,16+/m0/s1 |
| InChIKey | LKSMWYSNMDZLTB-OFQRWUPVSA-N |
| XLogP | 1.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|