C15H19NO2Se — CID 15870485
(7R,8R,8aS)-7-(hydroxymethyl)-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 15870485) has the molecular formula C15H19NO2Se and a molecular weight of 324.28 g/mol. Its IUPAC name is (7R,8R,8aS)-7-(hydroxymethyl)-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (7R,8R,8aS)-7-(hydroxymethyl)-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 15870485 |
| Molecular Formula | C15H19NO2Se |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | (7R,8R,8aS)-7-(hydroxymethyl)-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | O=C1C[C@H](CO)[C@@H]([Se]c2ccccc2)[C@@H]2CCCN12 |
| InChI | InChI=1S/C15H19NO2Se/c17-10-11-9-14(18)16-8-4-7-13(16)15(11)19-12-5-2-1-3-6-12/h1-3,5-6,11,13,15,17H,4,7-10H2/t11-,13+,15-/m1/s1 |
| InChIKey | SXISWVAUNJRNPF-OSAQELSMSA-N |
| XLogP | 0.81 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|