C15H19NO2 — CID 11579641
(7R,8S,8aS)-8a-hydroxy-8-methyl-7-phenyl-1,2,5,6,7,8-hexahydroindolizin-3-one (PubChem CID 11579641) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (7R,8S,8aS)-8a-hydroxy-8-methyl-7-phenyl-1,2,5,6,7,8-hexahydroindolizin-3-one.
| Compound Name | (7R,8S,8aS)-8a-hydroxy-8-methyl-7-phenyl-1,2,5,6,7,8-hexahydroindolizin-3-one |
|---|---|
| PubChem CID | 11579641 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (7R,8S,8aS)-8a-hydroxy-8-methyl-7-phenyl-1,2,5,6,7,8-hexahydroindolizin-3-one |
| SMILES | C[C@H]1[C@H](c2ccccc2)CCN2C(=O)CC[C@]12O |
| InChI | InChI=1S/C15H19NO2/c1-11-13(12-5-3-2-4-6-12)8-10-16-14(17)7-9-15(11,16)18/h2-6,11,13,18H,7-10H2,1H3/t11-,13+,15-/m0/s1 |
| InChIKey | NCXGLJPWPFNPEU-LNSITVRQSA-N |
| XLogP | 2.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |