C18H24NO3Se+ — CID 11048002
ethyl (7R,8R,8aS)-4-methyl-5-oxo-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-4-ium-7-carboxylate (PubChem CID 11048002) has the molecular formula C18H24NO3Se+ and a molecular weight of 381.35 g/mol. Its IUPAC name is ethyl (7R,8R,8aS)-4-methyl-5-oxo-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-4-ium-7-carboxylate.
| Compound Name | ethyl (7R,8R,8aS)-4-methyl-5-oxo-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-4-ium-7-carboxylate |
|---|---|
| PubChem CID | 11048002 |
| Molecular Formula | C18H24NO3Se+ |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | ethyl (7R,8R,8aS)-4-methyl-5-oxo-8-phenylselanyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-4-ium-7-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC(=O)[N+]2(C)CCC[C@H]2[C@@H]1[Se]c1ccccc1 |
| InChI | InChI=1S/C18H24NO3Se/c1-3-22-18(21)14-12-16(20)19(2)11-7-10-15(19)17(14)23-13-8-5-4-6-9-13/h4-6,8-9,14-15,17H,3,7,10-12H2,1-2H3/q+1/t14-,15-,17+,19?/m0/s1 |
| InChIKey | QJDCKPGFZHGJCK-JYPNTWJUSA-N |
| XLogP | 1.52 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|