C20H14F6N4O2 — CID 11070485
11-[2-(dimethylamino)ethyl]-4,5-bis(trifluoromethyl)-3,6,11-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,13,15-heptaene-10,12-dione (PubChem CID 11070485) has the molecular formula C20H14F6N4O2 and a molecular weight of 456.35 g/mol. Its IUPAC name is 11-[2-(dimethylamino)ethyl]-4,5-bis(trifluoromethyl)-3,6,11-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,13,15-heptaene-10,12-dione.
| Compound Name | 11-[2-(dimethylamino)ethyl]-4,5-bis(trifluoromethyl)-3,6,11-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,13,15-heptaene-10,12-dione |
|---|---|
| PubChem CID | 11070485 |
| Molecular Formula | C20H14F6N4O2 |
| Molecular Weight | 456.35 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 11-[2-(dimethylamino)ethyl]-4,5-bis(trifluoromethyl)-3,6,11-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),3,5,8,13,15-heptaene-10,12-dione |
| SMILES | CN(C)CCN1C(=O)c2cccc3c2c(cc2nc(C(F)(F)F)c(C(F)(F)F)nc23)C1=O |
| InChI | InChI=1S/C20H14F6N4O2/c1-29(2)6-7-30-17(31)10-5-3-4-9-13(10)11(18(30)32)8-12-14(9)28-16(20(24,25)26)15(27-12)19(21,22)23/h3-5,8H,6-7H2,1-2H3 |
| InChIKey | MWQJDAVHRKTCTB-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|