C24H31N7O2 — CID 141460464
6-[3-(3-aminopropylamino)propylamino]-11-[2-(dimethylamino)ethyl]-3,5,11-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-10,12-dione (PubChem CID 141460464) has the molecular formula C24H31N7O2 and a molecular weight of 449.56 g/mol. Its IUPAC name is 6-[3-(3-aminopropylamino)propylamino]-11-[2-(dimethylamino)ethyl]-3,5,11-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-10,12-dione.
| Compound Name | 6-[3-(3-aminopropylamino)propylamino]-11-[2-(dimethylamino)ethyl]-3,5,11-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-10,12-dione |
|---|---|
| PubChem CID | 141460464 |
| Molecular Formula | C24H31N7O2 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.25 |
| IUPAC Name | 6-[3-(3-aminopropylamino)propylamino]-11-[2-(dimethylamino)ethyl]-3,5,11-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-10,12-dione |
| SMILES | CN(C)CCN1C(=O)c2cccc3c2c(cc2c(NCCCNCCCN)ncnc23)C1=O |
| InChI | InChI=1S/C24H31N7O2/c1-30(2)12-13-31-23(32)17-7-3-6-16-20(17)18(24(31)33)14-19-21(16)28-15-29-22(19)27-11-5-10-26-9-4-8-25/h3,6-7,14-15,26H,4-5,8-13,25H2,1-2H3,(H,27,28,29) |
| InChIKey | VPYMFHIYBWKFCZ-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 116.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|