C26H32N6O2 — CID 171348773
11-[2-(dimethylamino)ethyl]-6-(4-pyrrolidin-1-ylbutylamino)-3,5,11-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-10,12-dione (PubChem CID 171348773) has the molecular formula C26H32N6O2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 11-[2-(dimethylamino)ethyl]-6-(4-pyrrolidin-1-ylbutylamino)-3,5,11-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-10,12-dione.
| Compound Name | 11-[2-(dimethylamino)ethyl]-6-(4-pyrrolidin-1-ylbutylamino)-3,5,11-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-10,12-dione |
|---|---|
| PubChem CID | 171348773 |
| Molecular Formula | C26H32N6O2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 11-[2-(dimethylamino)ethyl]-6-(4-pyrrolidin-1-ylbutylamino)-3,5,11-triazatetracyclo[7.7.1.02,7.013,17]heptadeca-1,3,5,7,9(17),13,15-heptaene-10,12-dione |
| SMILES | CN(C)CCN1C(=O)c2cccc3c2c(cc2c(NCCCCN4CCCC4)ncnc23)C1=O |
| InChI | InChI=1S/C26H32N6O2/c1-30(2)14-15-32-25(33)19-9-7-8-18-22(19)20(26(32)34)16-21-23(18)28-17-29-24(21)27-10-3-4-11-31-12-5-6-13-31/h7-9,16-17H,3-6,10-15H2,1-2H3,(H,27,28,29) |
| InChIKey | IGHVGMFVZYXIBQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|