C15H24N2O5S — CID 110709979
2,4-dimethoxy-N-[2-(4-methylmorpholin-2-yl)ethyl]benzenesulfonamide (PubChem CID 110709979) has the molecular formula C15H24N2O5S and a molecular weight of 344.43 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[2-(4-methylmorpholin-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 2,4-dimethoxy-N-[2-(4-methylmorpholin-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110709979 |
| Molecular Formula | C15H24N2O5S |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 2,4-dimethoxy-N-[2-(4-methylmorpholin-2-yl)ethyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCC2CN(C)CCO2)c(OC)c1 |
| InChI | InChI=1S/C15H24N2O5S/c1-17-8-9-22-13(11-17)6-7-16-23(18,19)15-5-4-12(20-2)10-14(15)21-3/h4-5,10,13,16H,6-9,11H2,1-3H3 |
| InChIKey | RUHYHLBXWSXNKO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |