C25H48O9Si — CID 11071407
[(3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3,4-bis(methoxymethoxy)-2-oxopentyl] 3-oxodecanoate (PubChem CID 11071407) has the molecular formula C25H48O9Si and a molecular weight of 520.74 g/mol. Its IUPAC name is [(3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3,4-bis(methoxymethoxy)-2-oxopentyl] 3-oxodecanoate.
| Compound Name | [(3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3,4-bis(methoxymethoxy)-2-oxopentyl] 3-oxodecanoate |
|---|---|
| PubChem CID | 11071407 |
| Molecular Formula | C25H48O9Si |
| Molecular Weight | 520.74 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | [(3S,4R)-5-[tert-butyl(dimethyl)silyl]oxy-3,4-bis(methoxymethoxy)-2-oxopentyl] 3-oxodecanoate |
| SMILES | CCCCCCCC(=O)CC(=O)OCC(=O)[C@@H](OCOC)[C@@H](CO[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C25H48O9Si/c1-9-10-11-12-13-14-20(26)15-23(28)31-16-21(27)24(33-19-30-6)22(32-18-29-5)17-34-35(7,8)25(2,3)4/h22,24H,9-19H2,1-8H3/t22-,24-/m1/s1 |
| InChIKey | YCAWFDCZTYCATN-ISKFKSNPSA-N |
| XLogP | 4.42 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.74 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|