C19H36O8Si — CID 25172711
methyl (2S)-2-[(4R,6S)-6-[(2R)-2-methoxy-3-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2-(2-trimethylsilylethoxymethoxy)acetate (PubChem CID 25172711) has the molecular formula C19H36O8Si and a molecular weight of 420.58 g/mol. Its IUPAC name is methyl (2S)-2-[(4R,6S)-6-[(2R)-2-methoxy-3-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2-(2-trimethylsilylethoxymethoxy)acetate.
| Compound Name | methyl (2S)-2-[(4R,6S)-6-[(2R)-2-methoxy-3-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2-(2-trimethylsilylethoxymethoxy)acetate |
|---|---|
| PubChem CID | 25172711 |
| Molecular Formula | C19H36O8Si |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | methyl (2S)-2-[(4R,6S)-6-[(2R)-2-methoxy-3-oxopropyl]-2,2-dimethyl-1,3-dioxan-4-yl]-2-(2-trimethylsilylethoxymethoxy)acetate |
| SMILES | COC(=O)[C@@H](OCOCC[Si](C)(C)C)[C@H]1C[C@@H](C[C@H](C=O)OC)OC(C)(C)O1 |
| InChI | InChI=1S/C19H36O8Si/c1-19(2)26-14(10-15(12-20)22-3)11-16(27-19)17(18(21)23-4)25-13-24-8-9-28(5,6)7/h12,14-17H,8-11,13H2,1-7H3/t14-,15-,16-,17+/m1/s1 |
| InChIKey | DZXSKESSLHZJDU-VQHPVUNQSA-N |
| XLogP | 2.37 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|