C16H13ClFNO2 — CID 110714186
1-(5-chloro-2,3-dihydroindol-1-yl)-2-(3-fluorophenoxy)ethanone (PubChem CID 110714186) has the molecular formula C16H13ClFNO2 and a molecular weight of 305.74 g/mol. Its IUPAC name is 1-(5-chloro-2,3-dihydroindol-1-yl)-2-(3-fluorophenoxy)ethanone.
| Compound Name | 1-(5-chloro-2,3-dihydroindol-1-yl)-2-(3-fluorophenoxy)ethanone |
|---|---|
| PubChem CID | 110714186 |
| Molecular Formula | C16H13ClFNO2 |
| Molecular Weight | 305.74 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 1-(5-chloro-2,3-dihydroindol-1-yl)-2-(3-fluorophenoxy)ethanone |
| SMILES | O=C(COc1cccc(F)c1)N1CCc2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H13ClFNO2/c17-12-4-5-15-11(8-12)6-7-19(15)16(20)10-21-14-3-1-2-13(18)9-14/h1-5,8-9H,6-7,10H2 |
| InChIKey | PXAPQQCZDFMKNH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.74 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |