C18H15F2NO3 — CID 71846325
2-(3-acetylphenoxy)-1-(5,7-difluoro-2,3-dihydroindol-1-yl)ethanone (PubChem CID 71846325) has the molecular formula C18H15F2NO3 and a molecular weight of 331.32 g/mol. Its IUPAC name is 2-(3-acetylphenoxy)-1-(5,7-difluoro-2,3-dihydroindol-1-yl)ethanone.
| Compound Name | 2-(3-acetylphenoxy)-1-(5,7-difluoro-2,3-dihydroindol-1-yl)ethanone |
|---|---|
| PubChem CID | 71846325 |
| Molecular Formula | C18H15F2NO3 |
| Molecular Weight | 331.32 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 2-(3-acetylphenoxy)-1-(5,7-difluoro-2,3-dihydroindol-1-yl)ethanone |
| SMILES | CC(=O)c1cccc(OCC(=O)N2CCc3cc(F)cc(F)c32)c1 |
| InChI | InChI=1S/C18H15F2NO3/c1-11(22)12-3-2-4-15(8-12)24-10-17(23)21-6-5-13-7-14(19)9-16(20)18(13)21/h2-4,7-9H,5-6,10H2,1H3 |
| InChIKey | IZZDKISUFUPRMJ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |