C14H24O4 — CID 11076066
(3aR,4R,5S,7aR)-5-heptyl-4-hydroxy-2,3,3a,4,5,7a-hexahydrofuro[2,3-c]pyran-7-one (PubChem CID 11076066) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is (3aR,4R,5S,7aR)-5-heptyl-4-hydroxy-2,3,3a,4,5,7a-hexahydrofuro[2,3-c]pyran-7-one.
| Compound Name | (3aR,4R,5S,7aR)-5-heptyl-4-hydroxy-2,3,3a,4,5,7a-hexahydrofuro[2,3-c]pyran-7-one |
|---|---|
| PubChem CID | 11076066 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | (3aR,4R,5S,7aR)-5-heptyl-4-hydroxy-2,3,3a,4,5,7a-hexahydrofuro[2,3-c]pyran-7-one |
| SMILES | CCCCCCC[C@@H]1OC(=O)[C@@H]2OCC[C@@H]2[C@H]1O |
| InChI | InChI=1S/C14H24O4/c1-2-3-4-5-6-7-11-12(15)10-8-9-17-13(10)14(16)18-11/h10-13,15H,2-9H2,1H3/t10-,11+,12-,13-/m1/s1 |
| InChIKey | RUAKFXBGZCYCLA-YVECIDJPSA-N |
| XLogP | 2.04 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|