C13H20NO3PS — CID 11077473
5-diethoxyphosphoryl-7-methyl-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 11077473) has the molecular formula C13H20NO3PS and a molecular weight of 301.35 g/mol. Its IUPAC name is 5-diethoxyphosphoryl-7-methyl-3,4-dihydro-2H-1,4-benzothiazine.
| Compound Name | 5-diethoxyphosphoryl-7-methyl-3,4-dihydro-2H-1,4-benzothiazine |
|---|---|
| PubChem CID | 11077473 |
| Molecular Formula | C13H20NO3PS |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 5-diethoxyphosphoryl-7-methyl-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | CCOP(=O)(OCC)c1cc(C)cc2c1NCCS2 |
| InChI | InChI=1S/C13H20NO3PS/c1-4-16-18(15,17-5-2)11-8-10(3)9-12-13(11)14-6-7-19-12/h8-9,14H,4-7H2,1-3H3 |
| InChIKey | NBBCTPFYLDOQGQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|