C25H33BO6 — CID 11080684
4-methoxy-6-[(E,3S)-2-methyl-3-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-yl]pyran-2-one (PubChem CID 11080684) has the molecular formula C25H33BO6 and a molecular weight of 440.35 g/mol. Its IUPAC name is 4-methoxy-6-[(E,3S)-2-methyl-3-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-yl]pyran-2-one.
| Compound Name | 4-methoxy-6-[(E,3S)-2-methyl-3-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-yl]pyran-2-one |
|---|---|
| PubChem CID | 11080684 |
| Molecular Formula | C25H33BO6 |
| Molecular Weight | 440.35 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 4-methoxy-6-[(E,3S)-2-methyl-3-phenylmethoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-en-2-yl]pyran-2-one |
| SMILES | COc1cc(C(C)(C)[C@H](/C=C/B2OC(C)(C)C(C)(C)O2)OCc2ccccc2)oc(=O)c1 |
| InChI | InChI=1S/C25H33BO6/c1-23(2,21-15-19(28-7)16-22(27)30-21)20(29-17-18-11-9-8-10-12-18)13-14-26-31-24(3,4)25(5,6)32-26/h8-16,20H,17H2,1-7H3/b14-13+/t20-/m0/s1 |
| InChIKey | ICNOYWJSVNCNKD-AIGDTVQASA-N |
| XLogP | 4.70 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.35 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|