C16H26BNO3 — CID 174355745
N-methyl-2-phenylmethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethanamine (PubChem CID 174355745) has the molecular formula C16H26BNO3 and a molecular weight of 291.20 g/mol. Its IUPAC name is N-methyl-2-phenylmethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethanamine.
| Compound Name | N-methyl-2-phenylmethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethanamine |
|---|---|
| PubChem CID | 174355745 |
| Molecular Formula | C16H26BNO3 |
| Molecular Weight | 291.20 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | N-methyl-2-phenylmethoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethanamine |
| SMILES | CNCC(OCc1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H26BNO3/c1-15(2)16(3,4)21-17(20-15)14(11-18-5)19-12-13-9-7-6-8-10-13/h6-10,14,18H,11-12H2,1-5H3 |
| InChIKey | UUQCVOKPKUBPTH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|